C30H19N3O4 — CID 91464774
14-hydroxy-13-methyl-6-[2-(4-methylphenyl)-3H-benzimidazol-5-yl]-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10,13-hexaene-5,7,12-trione (PubChem CID 91464774) has the molecular formula C30H19N3O4 and a molecular weight of 485.50 g/mol. Its IUPAC name is 14-hydroxy-13-methyl-6-[2-(4-methylphenyl)-3H-benzimidazol-5-yl]-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10,13-hexaene-5,7,12-trione.
| Compound Name | 14-hydroxy-13-methyl-6-[2-(4-methylphenyl)-3H-benzimidazol-5-yl]-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10,13-hexaene-5,7,12-trione |
|---|---|
| PubChem CID | 91464774 |
| Molecular Formula | C30H19N3O4 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 14-hydroxy-13-methyl-6-[2-(4-methylphenyl)-3H-benzimidazol-5-yl]-6-azatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10,13-hexaene-5,7,12-trione |
| SMILES | CC1=C(O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(c1ccc2nc(-c4ccc(C)cc4)[nH]c2c1)C3=O |
| InChI | InChI=1S/C30H19N3O4/c1-14-3-5-16(6-4-14)28-31-22-12-7-17(13-23(22)32-28)33-29(36)20-10-8-18-24-19(27(35)15(2)26(18)34)9-11-21(25(20)24)30(33)37/h3-13,34H,1-2H3,(H,31,32) |
| InChIKey | DLZATVAHDGXNSZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|