C6H8N4 — CID 91465388
cyclohexane-1,2,3,4-tetraimine (PubChem CID 91465388) has the molecular formula C6H8N4 and a molecular weight of 136.16 g/mol. Its IUPAC name is cyclohexane-1,2,3,4-tetraimine.
| Compound Name | cyclohexane-1,2,3,4-tetraimine |
|---|---|
| PubChem CID | 91465388 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | cyclohexane-1,2,3,4-tetraimine |
| SMILES | [H]/N=C1CCC(=N\[H])/C(=N\[H])C\1=N/[H] |
| InChI | InChI=1S/C6H8N4/c7-3-1-2-4(8)6(10)5(3)9/h7-10H,1-2H2/b7-3+,8-4+,9-5+,10-6+ |
| InChIKey | WCBNHAJHRNMLCS-JMFUVXGRSA-N |
| XLogP | 0.86 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|