C6H10N4O — CID 91465659
2,3,4a,7,8,8a-hexahydro-1H-pteridin-4-one (PubChem CID 91465659) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 2,3,4a,7,8,8a-hexahydro-1H-pteridin-4-one.
| Compound Name | 2,3,4a,7,8,8a-hexahydro-1H-pteridin-4-one |
|---|---|
| PubChem CID | 91465659 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 2,3,4a,7,8,8a-hexahydro-1H-pteridin-4-one |
| SMILES | O=C1NCNC2NCC=NC12 |
| InChI | InChI=1S/C6H10N4O/c11-6-4-5(9-3-10-6)8-2-1-7-4/h1,4-5,8-9H,2-3H2,(H,10,11) |
| InChIKey | SKDJCXHBJWMVFC-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |