C12H11N5O4S — CID 9146573
2-[2-[(3-amino-1H-1,2,4-triazol-5-yl)sulfonyl]ethyl]isoindole-1,3-dione (PubChem CID 9146573) has the molecular formula C12H11N5O4S and a molecular weight of 321.32 g/mol. Its IUPAC name is 2-[2-[(3-amino-1H-1,2,4-triazol-5-yl)sulfonyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(3-amino-1H-1,2,4-triazol-5-yl)sulfonyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9146573 |
| Molecular Formula | C12H11N5O4S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[2-[(3-amino-1H-1,2,4-triazol-5-yl)sulfonyl]ethyl]isoindole-1,3-dione |
| SMILES | Nc1n[nH]c(S(=O)(=O)CCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C12H11N5O4S/c13-11-14-12(16-15-11)22(20,21)6-5-17-9(18)7-3-1-2-4-8(7)10(17)19/h1-4H,5-6H2,(H3,13,14,15,16) |
| InChIKey | QHIGGKYVUVLMDZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|