C27H50N3+ — CID 91466054
4-[butan-2-yl(propyl)amino]pent-4-enyl-methylidene-[1-(1-pent-3-en-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propan-2-yl]azanium (PubChem CID 91466054) has the molecular formula C27H50N3+ and a molecular weight of 416.72 g/mol. Its IUPAC name is 4-[butan-2-yl(propyl)amino]pent-4-enyl-methylidene-[1-(1-pent-3-en-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propan-2-yl]azanium.
| Compound Name | 4-[butan-2-yl(propyl)amino]pent-4-enyl-methylidene-[1-(1-pent-3-en-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propan-2-yl]azanium |
|---|---|
| PubChem CID | 91466054 |
| Molecular Formula | C27H50N3+ |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 416.40 |
| IUPAC Name | 4-[butan-2-yl(propyl)amino]pent-4-enyl-methylidene-[1-(1-pent-3-en-2-yl-2,3,6,7-tetrahydroazepin-4-yl)propan-2-yl]azanium |
| SMILES | C=C(CCC[N+](=C)C(C)CC1=CCCN(C(C)C=CC)CC1)N(CCC)C(C)CC |
| InChI | InChI=1S/C27H50N3/c1-9-14-24(5)29-20-13-16-27(17-21-29)22-26(7)28(8)19-12-15-25(6)30(18-10-2)23(4)11-3/h9,14,16,23-24,26H,6,8,10-13,15,17-22H2,1-5,7H3/q+1 |
| InChIKey | OMWVBQYWQYAVJY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|