C20H20F6N5O4PS — CID 91466448
[1-[(2-amino-6-phenylsulfanylpurin-9-yl)methyl]cyclopropyl]peroxy-(1,1,1,5,5,5-hexafluoropentan-3-yl)phosphinic acid (PubChem CID 91466448) has the molecular formula C20H20F6N5O4PS and a molecular weight of 571.44 g/mol. Its IUPAC name is [1-[(2-amino-6-phenylsulfanylpurin-9-yl)methyl]cyclopropyl]peroxy-(1,1,1,5,5,5-hexafluoropentan-3-yl)phosphinic acid.
| Compound Name | [1-[(2-amino-6-phenylsulfanylpurin-9-yl)methyl]cyclopropyl]peroxy-(1,1,1,5,5,5-hexafluoropentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 91466448 |
| Molecular Formula | C20H20F6N5O4PS |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.09 |
| IUPAC Name | [1-[(2-amino-6-phenylsulfanylpurin-9-yl)methyl]cyclopropyl]peroxy-(1,1,1,5,5,5-hexafluoropentan-3-yl)phosphinic acid |
| SMILES | Nc1nc(Sc2ccccc2)c2ncn(CC3(OOP(=O)(O)C(CC(F)(F)F)CC(F)(F)F)CC3)c2n1 |
| InChI | InChI=1S/C20H20F6N5O4PS/c21-19(22,23)8-12(9-20(24,25)26)36(32,33)35-34-18(6-7-18)10-31-11-28-14-15(31)29-17(27)30-16(14)37-13-4-2-1-3-5-13/h1-5,11-12H,6-10H2,(H,32,33)(H2,27,29,30) |
| InChIKey | PHQJMGCHSGQUPY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|