About [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate
[[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate (PubChem CID 91466532) has the molecular formula C28H28FN3O2
and a molecular weight of 457.55 g/mol. Its IUPAC name is [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate |
| PubChem CID | 91466532 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)ONC(c1cn[nH]c1)c1ccc(F)c(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C28H28FN3O2/c1-28(2,3)16-26(33)34-32-27(23-17-30-31-18-23)22-13-14-25(29)24(15-22)21-11-9-20(10-12-21)19-7-5-4-6-8-19/h4-15,17-18,27,32H,16H2,1-3H3,(H,30,31) |
| InChIKey | FEMUOJOJXONDRS-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate?
The IUPAC name of [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate (CID 91466532) is [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate.
What is the SMILES notation for [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate?
The canonical SMILES for [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate is CC(C)(C)CC(=O)ONC(c1cn[nH]c1)c1ccc(F)c(-c2ccc(-c3ccccc3)cc2)c1.
What is the InChIKey of [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate?
The InChIKey is FEMUOJOJXONDRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28FN3O2/c1-28(2,3)16-26(33)34-32-27(23-17-30-31-18-23)22-13-14-25(29)24(15-22)21-11-9-20(10-12-21)19-7-5-4-6-8-19/h4-15,17-18,27,32H,16H2,1-3H3,(H,30,31).
What are the key properties of [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate?
[[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate has a molecular weight of 457.55 g/mol, XLogP of 6.46, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[[4-fluoro-3-(4-phenylphenyl)phenyl]-(1H-pyrazol-4-yl)methyl]amino] 3,3-dimethylbutanoate is sourced from PubChem (CID 91466532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).