C9H6F3N2O2S- — CID 91466604
2-cyano-1-[2,2-difluoroethyl(sulfinato)amino]-4-fluorobenzene (PubChem CID 91466604) has the molecular formula C9H6F3N2O2S- and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-cyano-1-[2,2-difluoroethyl(sulfinato)amino]-4-fluorobenzene.
| Compound Name | 2-cyano-1-[2,2-difluoroethyl(sulfinato)amino]-4-fluorobenzene |
|---|---|
| PubChem CID | 91466604 |
| Molecular Formula | C9H6F3N2O2S- |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-cyano-1-[2,2-difluoroethyl(sulfinato)amino]-4-fluorobenzene |
| SMILES | N#Cc1cc(F)ccc1N(CC(F)F)S(=O)[O-] |
| InChI | InChI=1S/C9H7F3N2O2S/c10-7-1-2-8(6(3-7)4-13)14(17(15)16)5-9(11)12/h1-3,9H,5H2,(H,15,16)/p-1 |
| InChIKey | HCOBIWOLPLFONY-UHFFFAOYSA-M |
| XLogP | 1.56 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|