C12H19NO4 — CID 91466917
(2S,3aR,7aR)-6-ethyl-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylic acid (PubChem CID 91466917) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2S,3aR,7aR)-6-ethyl-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylic acid.
| Compound Name | (2S,3aR,7aR)-6-ethyl-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 91466917 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2S,3aR,7aR)-6-ethyl-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylic acid |
| SMILES | CCC1CC[C@@H]2C[C@@H](C(=O)O)N(C(=O)O)[C@@H]2C1 |
| InChI | InChI=1S/C12H19NO4/c1-2-7-3-4-8-6-10(11(14)15)13(12(16)17)9(8)5-7/h7-10H,2-6H2,1H3,(H,14,15)(H,16,17)/t7?,8-,9-,10+/m1/s1 |
| InChIKey | AIOPJSNDNLOJBO-BDBFLJFWSA-N |
| XLogP | 2.02 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |