C6H9NO — CID 91467008
5-methyl-4,5-dihydro-2H-pyridin-3-one (PubChem CID 91467008) has the molecular formula C6H9NO and a molecular weight of 111.14 g/mol. Its IUPAC name is 5-methyl-4,5-dihydro-2H-pyridin-3-one.
| Compound Name | 5-methyl-4,5-dihydro-2H-pyridin-3-one |
|---|---|
| PubChem CID | 91467008 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 5-methyl-4,5-dihydro-2H-pyridin-3-one |
| SMILES | CC1C=NCC(=O)C1 |
| InChI | InChI=1S/C6H9NO/c1-5-2-6(8)4-7-3-5/h3,5H,2,4H2,1H3 |
| InChIKey | VKHACZGGJOJOSL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |