C11H13N3O — CID 91467094
4a,5,8,10a-tetrahydropyrido[2,3-b]azocine-6-carboxamide (PubChem CID 91467094) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 4a,5,8,10a-tetrahydropyrido[2,3-b]azocine-6-carboxamide.
| Compound Name | 4a,5,8,10a-tetrahydropyrido[2,3-b]azocine-6-carboxamide |
|---|---|
| PubChem CID | 91467094 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4a,5,8,10a-tetrahydropyrido[2,3-b]azocine-6-carboxamide |
| SMILES | NC(=O)C1=CCC=NC2N=CC=CC2C1 |
| InChI | InChI=1S/C11H13N3O/c12-10(15)8-3-1-5-13-11-9(7-8)4-2-6-14-11/h2-6,9,11H,1,7H2,(H2,12,15) |
| InChIKey | REUGPRLNNQHCAH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |