C20H21ClN6O2 — CID 91467398
methyl 3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate (PubChem CID 91467398) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is methyl 3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate.
| Compound Name | methyl 3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91467398 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | methyl 3-[4-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1[nH]nc2ncnc(N3CCN(c4cc(Cl)ccc4C)CC3)c12 |
| InChI | InChI=1S/C20H21ClN6O2/c1-13-3-4-14(21)11-16(13)26-7-9-27(10-8-26)20-18-15(5-6-17(28)29-2)24-25-19(18)22-12-23-20/h3-6,11-12H,7-10H2,1-2H3,(H,22,23,24,25) |
| InChIKey | BMUJTWYRHBCTOP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|