About 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane
4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane (PubChem CID 91467405) has the molecular formula C17H18N2OS
and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane.
Molecular Properties
| Compound Name | 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane |
| PubChem CID | 91467405 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane |
| SMILES | CCC.NC(=O)c1cc2c(-c3ccccc3)cncc2s1 |
| InChI | InChI=1S/C14H10N2OS.C3H8/c15-14(17)12-6-10-11(7-16-8-13(10)18-12)9-4-2-1-3-5-9;1-3-2/h1-8H,(H2,15,17);3H2,1-2H3 |
| InChIKey | RYEQYXQWSRZNPW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane?
The IUPAC name of 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane (CID 91467405) is 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane.
What is the SMILES notation for 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane?
The canonical SMILES for 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane is CCC.NC(=O)c1cc2c(-c3ccccc3)cncc2s1.
What is the InChIKey of 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane?
The InChIKey is RYEQYXQWSRZNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2OS.C3H8/c15-14(17)12-6-10-11(7-16-8-13(10)18-12)9-4-2-1-3-5-9;1-3-2/h1-8H,(H2,15,17);3H2,1-2H3.
What are the key properties of 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane?
4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane has a molecular weight of 298.41 g/mol, XLogP of 4.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylthieno[2,3-c]pyridine-2-carboxamide;propane is sourced from PubChem (CID 91467405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).