C8H13N5O — CID 914675
3-N-(cyclohexylideneamino)-1,2,5-oxadiazole-3,4-diamine (PubChem CID 914675) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 3-N-(cyclohexylideneamino)-1,2,5-oxadiazole-3,4-diamine.
| Compound Name | 3-N-(cyclohexylideneamino)-1,2,5-oxadiazole-3,4-diamine |
|---|---|
| PubChem CID | 914675 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 3-N-(cyclohexylideneamino)-1,2,5-oxadiazole-3,4-diamine |
| SMILES | Nc1nonc1NN=C1CCCCC1 |
| InChI | InChI=1S/C8H13N5O/c9-7-8(13-14-12-7)11-10-6-4-2-1-3-5-6/h1-5H2,(H2,9,12)(H,11,13) |
| InChIKey | VFYWLVNRQKDHHQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|