C10H20O2S — CID 91468110
(2R,5R)-4-(1-ethylsulfanylethyl)-2,5-dimethyl-1,3-dioxane (PubChem CID 91468110) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is (2R,5R)-4-(1-ethylsulfanylethyl)-2,5-dimethyl-1,3-dioxane.
| Compound Name | (2R,5R)-4-(1-ethylsulfanylethyl)-2,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 91468110 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R,5R)-4-(1-ethylsulfanylethyl)-2,5-dimethyl-1,3-dioxane |
| SMILES | CCSC(C)C1O[C@H](C)OC[C@H]1C |
| InChI | InChI=1S/C10H20O2S/c1-5-13-8(3)10-7(2)6-11-9(4)12-10/h7-10H,5-6H2,1-4H3/t7-,8?,9-,10?/m1/s1 |
| InChIKey | NMMHYRUGLZZOMC-PRWFHZCQSA-N |
| XLogP | 2.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |