C19H29N3OS — CID 91468144
N-butyl-5-[4-[3-[(2-methylpropan-2-yl)oxy]propyl]phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 91468144) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is N-butyl-5-[4-[3-[(2-methylpropan-2-yl)oxy]propyl]phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-butyl-5-[4-[3-[(2-methylpropan-2-yl)oxy]propyl]phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 91468144 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | N-butyl-5-[4-[3-[(2-methylpropan-2-yl)oxy]propyl]phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCNc1nnc(-c2ccc(CCCOC(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C19H29N3OS/c1-5-6-13-20-18-22-21-17(24-18)16-11-9-15(10-12-16)8-7-14-23-19(2,3)4/h9-12H,5-8,13-14H2,1-4H3,(H,20,22) |
| InChIKey | BRDRKLVEMIYPQI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|