C15H20NO2+ — CID 91468383
tert-butyl 2-azoniatricyclo[6.2.1.02,7]undeca-4,6,9-triene-2-carboxylate (PubChem CID 91468383) has the molecular formula C15H20NO2+ and a molecular weight of 246.33 g/mol. Its IUPAC name is tert-butyl 2-azoniatricyclo[6.2.1.02,7]undeca-4,6,9-triene-2-carboxylate.
| Compound Name | tert-butyl 2-azoniatricyclo[6.2.1.02,7]undeca-4,6,9-triene-2-carboxylate |
|---|---|
| PubChem CID | 91468383 |
| Molecular Formula | C15H20NO2+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | tert-butyl 2-azoniatricyclo[6.2.1.02,7]undeca-4,6,9-triene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[N+]12CC=CC=C1C1C=CC2C1 |
| InChI | InChI=1S/C15H20NO2/c1-15(2,3)18-14(17)16-9-5-4-6-13(16)11-7-8-12(16)10-11/h4-8,11-12H,9-10H2,1-3H3/q+1 |
| InChIKey | MUDYSYIEFKZMGS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|