C16H17ClFN3O3 — CID 9146871
N-(3-chloro-2-fluorophenyl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide (PubChem CID 9146871) has the molecular formula C16H17ClFN3O3 and a molecular weight of 353.78 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide.
| Compound Name | N-(3-chloro-2-fluorophenyl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
|---|---|
| PubChem CID | 9146871 |
| Molecular Formula | C16H17ClFN3O3 |
| Molecular Weight | 353.78 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propanamide |
| SMILES | O=C(CCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(Cl)c1F |
| InChI | InChI=1S/C16H17ClFN3O3/c17-10-4-3-5-11(13(10)18)19-12(22)6-9-21-14(23)16(20-15(21)24)7-1-2-8-16/h3-5H,1-2,6-9H2,(H,19,22)(H,20,24) |
| InChIKey | PNNCGGLAFIIGQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.78 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|