About 2-cyclopropylanthracene
2-cyclopropylanthracene (PubChem CID 91468721) has the molecular formula C17H14
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-cyclopropylanthracene.
Molecular Properties
| Compound Name | 2-cyclopropylanthracene |
| PubChem CID | 91468721 |
| Molecular Formula | C17H14 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-cyclopropylanthracene |
| SMILES | c1ccc2cc3cc(C4CC4)ccc3cc2c1 |
| InChI | InChI=1S/C17H14/c1-2-4-14-10-17-11-15(12-5-6-12)7-8-16(17)9-13(14)3-1/h1-4,7-12H,5-6H2 |
| InChIKey | USBQDLPRTRCSNG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylanthracene?
The IUPAC name of 2-cyclopropylanthracene (CID 91468721) is 2-cyclopropylanthracene.
What is the SMILES notation for 2-cyclopropylanthracene?
The canonical SMILES for 2-cyclopropylanthracene is c1ccc2cc3cc(C4CC4)ccc3cc2c1.
What is the InChIKey of 2-cyclopropylanthracene?
The InChIKey is USBQDLPRTRCSNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14/c1-2-4-14-10-17-11-15(12-5-6-12)7-8-16(17)9-13(14)3-1/h1-4,7-12H,5-6H2.
What are the key properties of 2-cyclopropylanthracene?
2-cyclopropylanthracene has a molecular weight of 218.30 g/mol, XLogP of 4.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylanthracene is sourced from PubChem (CID 91468721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).