About 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine
2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine (PubChem CID 91468924) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine.
Molecular Properties
| Compound Name | 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine |
| PubChem CID | 91468924 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine |
| SMILES | C/N=C(\C)C1CCCC1=CCN |
| InChI | InChI=1S/C10H18N2/c1-8(12-2)10-5-3-4-9(10)6-7-11/h6,10H,3-5,7,11H2,1-2H3/b9-6?,12-8+ |
| InChIKey | PQCUSURIYMULDQ-XDXHVUSISA-N |
| XLogP | 1.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine?
The IUPAC name of 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine (CID 91468924) is 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine.
What is the SMILES notation for 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine?
The canonical SMILES for 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine is C/N=C(\C)C1CCCC1=CCN.
What is the InChIKey of 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine?
The InChIKey is PQCUSURIYMULDQ-XDXHVUSISA-N. The full InChI is InChI=1S/C10H18N2/c1-8(12-2)10-5-3-4-9(10)6-7-11/h6,10H,3-5,7,11H2,1-2H3/b9-6?,12-8+.
What are the key properties of 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine?
2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine has a molecular weight of 166.27 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(C,N-dimethylcarbonimidoyl)cyclopentylidene]ethanamine is sourced from PubChem (CID 91468924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).