C9H14N2O7S3 — CID 91469399
4-(ethylamino)-5,5,6-trihydroxy-7,7-dioxo-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide (PubChem CID 91469399) has the molecular formula C9H14N2O7S3 and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-(ethylamino)-5,5,6-trihydroxy-7,7-dioxo-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide.
| Compound Name | 4-(ethylamino)-5,5,6-trihydroxy-7,7-dioxo-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide |
|---|---|
| PubChem CID | 91469399 |
| Molecular Formula | C9H14N2O7S3 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 4-(ethylamino)-5,5,6-trihydroxy-7,7-dioxo-4,6-dihydrothieno[2,3-b]thiopyran-2-sulfonamide |
| SMILES | CCNC1c2cc(S(N)(=O)=O)sc2S(=O)(=O)C(O)C1(O)O |
| InChI | InChI=1S/C9H14N2O7S3/c1-2-11-6-4-3-5(21(10,17)18)19-7(4)20(15,16)8(12)9(6,13)14/h3,6,8,11-14H,2H2,1H3,(H2,10,17,18) |
| InChIKey | YHDVGWKFHIDAKR-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|