C21H23N3O3 — CID 91469636
1-[4-[(2S)-3,3-dimethyl-2-(3-nitrophenyl)butoxy]phenyl]imidazole (PubChem CID 91469636) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[4-[(2S)-3,3-dimethyl-2-(3-nitrophenyl)butoxy]phenyl]imidazole.
| Compound Name | 1-[4-[(2S)-3,3-dimethyl-2-(3-nitrophenyl)butoxy]phenyl]imidazole |
|---|---|
| PubChem CID | 91469636 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[4-[(2S)-3,3-dimethyl-2-(3-nitrophenyl)butoxy]phenyl]imidazole |
| SMILES | CC(C)(C)[C@H](COc1ccc(-n2ccnc2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O3/c1-21(2,3)20(16-5-4-6-18(13-16)24(25)26)14-27-19-9-7-17(8-10-19)23-12-11-22-15-23/h4-13,15,20H,14H2,1-3H3/t20-/m1/s1 |
| InChIKey | QMQORCIYNATLDN-HXUWFJFHSA-N |
| XLogP | 4.99 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|