C48H50BBrF4N7O4S — CID 91469812
CID 91469812 (PubChem CID 91469812) has the molecular formula C48H50BBrF4N7O4S and a molecular weight of 987.75 g/mol.
| Compound Name | CID 91469812 |
|---|---|
| PubChem CID | 91469812 |
| Molecular Formula | C48H50BBrF4N7O4S |
| Molecular Weight | 987.75 g/mol |
| Exact Mass | 986.29 |
| IUPAC Name | — |
| SMILES | C=C(C)c1c(C)n(Cc2c(F)cccc2F)c(=O)n(C[C@H](NC)c2ccccc2)c1=O.C=C(CBr)c1c(C)n(Cc2c(F)cccc2F)c(=O)n(C[C@H](NC)c2ccccc2)c1=O.[B]=NS |
| InChI | InChI=1S/C24H24BrF2N3O2.C24H25F2N3O2.BHNS/c1-15(12-25)22-16(2)29(13-18-19(26)10-7-11-20(18)27)24(32)30(23(22)31)14-21(28-3)17-8-5-4-6-9-17;1-15(2)22-16(3)28(13-18-19(25)11-8-12-20(18)26)24(31)29(23(22)30)14-21(27-4)17-9-6-5-7-10-17;1-2-3/h4-11,21,28H,1,12-14H2,2-3H3;5-12,21,27H,1,13-14H2,2-4H3;3H/t2*21-;/m00./s1 |
| InChIKey | QJVZIFFMTHBWTL-HRQBZJEISA-N |
| XLogP | 7.84 |
| TPSA | 124.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.75 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|