C21H20N2O2 — CID 91469884
(E,4Z)-2-benzoyl-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enenitrile;ethane (PubChem CID 91469884) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (E,4Z)-2-benzoyl-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enenitrile;ethane.
| Compound Name | (E,4Z)-2-benzoyl-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enenitrile;ethane |
|---|---|
| PubChem CID | 91469884 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (E,4Z)-2-benzoyl-4-(3-methyl-1,3-benzoxazol-2-ylidene)but-2-enenitrile;ethane |
| SMILES | CC.CN1/C(=C/C=C(\C#N)C(=O)c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C19H14N2O2.C2H6/c1-21-16-9-5-6-10-17(16)23-18(21)12-11-15(13-20)19(22)14-7-3-2-4-8-14;1-2/h2-12H,1H3;1-2H3/b15-11+,18-12-; |
| InChIKey | ORFRSAZFQMXGTH-HPTYCUNSSA-N |
| XLogP | 4.72 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|