About 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile
4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile (PubChem CID 91470345) has the molecular formula C13H10F3N3
and a molecular weight of 265.24 g/mol. Its IUPAC name is 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile |
| PubChem CID | 91470345 |
| Molecular Formula | C13H10F3N3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile |
| SMILES | Cc1ccc(C#N)cc1-c1cn[nH]c1CC(F)(F)F |
| InChI | InChI=1S/C13H10F3N3/c1-8-2-3-9(6-17)4-10(8)11-7-18-19-12(11)5-13(14,15)16/h2-4,7H,5H2,1H3,(H,18,19) |
| InChIKey | XVQWRXKEBCQHPK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile?
The IUPAC name of 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile (CID 91470345) is 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile.
What is the SMILES notation for 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile?
The canonical SMILES for 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile is Cc1ccc(C#N)cc1-c1cn[nH]c1CC(F)(F)F.
What is the InChIKey of 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile?
The InChIKey is XVQWRXKEBCQHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N3/c1-8-2-3-9(6-17)4-10(8)11-7-18-19-12(11)5-13(14,15)16/h2-4,7H,5H2,1H3,(H,18,19).
What are the key properties of 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile?
4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile has a molecular weight of 265.24 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[5-(2,2,2-trifluoroethyl)-1H-pyrazol-4-yl]benzonitrile is sourced from PubChem (CID 91470345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).