About [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone
[3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone (PubChem CID 91470423) has the molecular formula C22H15F3N2O2
and a molecular weight of 396.37 g/mol. Its IUPAC name is [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone.
Molecular Properties
| Compound Name | [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone |
| PubChem CID | 91470423 |
| Molecular Formula | C22H15F3N2O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)c1cc(O)cc(-c2cccc3[nH]cc(CC(F)(F)F)c23)c1 |
| InChI | InChI=1S/C22H15F3N2O2/c23-22(24,25)10-16-12-27-19-5-1-4-18(20(16)19)14-7-15(9-17(28)8-14)21(29)13-3-2-6-26-11-13/h1-9,11-12,27-28H,10H2 |
| InChIKey | LEXVXDLTRGOKPQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone?
The IUPAC name of [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone (CID 91470423) is [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone.
What is the SMILES notation for [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone?
The canonical SMILES for [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone is O=C(c1cccnc1)c1cc(O)cc(-c2cccc3[nH]cc(CC(F)(F)F)c23)c1.
What is the InChIKey of [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone?
The InChIKey is LEXVXDLTRGOKPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O2/c23-22(24,25)10-16-12-27-19-5-1-4-18(20(16)19)14-7-15(9-17(28)8-14)21(29)13-3-2-6-26-11-13/h1-9,11-12,27-28H,10H2.
What are the key properties of [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone?
[3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone has a molecular weight of 396.37 g/mol, XLogP of 5.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-5-[3-(2,2,2-trifluoroethyl)-1H-indol-4-yl]phenyl]-pyridin-3-ylmethanone is sourced from PubChem (CID 91470423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).