C20H20F4O5 — CID 91470471
4-[3-[4-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-2-(tritiomethyl)phenoxy]propoxy]benzoic acid (PubChem CID 91470471) has the molecular formula C20H20F4O5 and a molecular weight of 418.38 g/mol. Its IUPAC name is 4-[3-[4-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-2-(tritiomethyl)phenoxy]propoxy]benzoic acid.
| Compound Name | 4-[3-[4-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-2-(tritiomethyl)phenoxy]propoxy]benzoic acid |
|---|---|
| PubChem CID | 91470471 |
| Molecular Formula | C20H20F4O5 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[3-[4-(1,1,1,3-tetrafluoro-2-hydroxypropan-2-yl)-2-(tritiomethyl)phenoxy]propoxy]benzoic acid |
| SMILES | [3H]Cc1cc(C(O)(CF)C(F)(F)F)ccc1OCCCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H20F4O5/c1-13-11-15(19(27,12-21)20(22,23)24)5-8-17(13)29-10-2-9-28-16-6-3-14(4-7-16)18(25)26/h3-8,11,27H,2,9-10,12H2,1H3,(H,25,26)/i1T |
| InChIKey | ADAUUHCUDMZXLC-CNRUNOGKSA-N |
| XLogP | 4.26 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|