C15H15N — CID 91470912
2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-3,5,9,11,13-pentaene (PubChem CID 91470912) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-3,5,9,11,13-pentaene.
| Compound Name | 2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-3,5,9,11,13-pentaene |
|---|---|
| PubChem CID | 91470912 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-azatetracyclo[10.2.2.02,11.04,9]hexadeca-3,5,9,11,13-pentaene |
| SMILES | C1=CC2=CN3C(=C4C=CC3CC4)C=C2CC1 |
| InChI | InChI=1S/C15H15N/c1-2-4-13-10-16-14-7-5-11(6-8-14)15(16)9-12(13)3-1/h2,4-5,7,9-10,14H,1,3,6,8H2 |
| InChIKey | QEUHWUHBOPDTBA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |