C23H28N4 — CID 91471707
(2R,3R)-N-[5-(2,3-dimethyl-1H-indol-5-yl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 91471707) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is (2R,3R)-N-[5-(2,3-dimethyl-1H-indol-5-yl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | (2R,3R)-N-[5-(2,3-dimethyl-1H-indol-5-yl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 91471707 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2R,3R)-N-[5-(2,3-dimethyl-1H-indol-5-yl)-2-pyridinyl]-2-methyl-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Cc1[nH]c2ccc(-c3ccc(N[C@@H]4C5CCN(CC5)[C@@H]4C)nc3)cc2c1C |
| InChI | InChI=1S/C23H28N4/c1-14-15(2)25-21-6-4-18(12-20(14)21)19-5-7-22(24-13-19)26-23-16(3)27-10-8-17(23)9-11-27/h4-7,12-13,16-17,23,25H,8-11H2,1-3H3,(H,24,26)/t16-,23+/m1/s1 |
| InChIKey | ZYEHZIXAKDZPNY-MWTRTKDXSA-N |
| XLogP | 4.74 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|