C23H27N2O+ — CID 91471711
[4-[4-(dimethylamino)phenyl]cyclohexa-2,5-dien-1-ylidene]-ethyl-[3-(furan-2-yl)prop-2-enyl]azanium (PubChem CID 91471711) has the molecular formula C23H27N2O+ and a molecular weight of 347.48 g/mol. Its IUPAC name is [4-[4-(dimethylamino)phenyl]cyclohexa-2,5-dien-1-ylidene]-ethyl-[3-(furan-2-yl)prop-2-enyl]azanium.
| Compound Name | [4-[4-(dimethylamino)phenyl]cyclohexa-2,5-dien-1-ylidene]-ethyl-[3-(furan-2-yl)prop-2-enyl]azanium |
|---|---|
| PubChem CID | 91471711 |
| Molecular Formula | C23H27N2O+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [4-[4-(dimethylamino)phenyl]cyclohexa-2,5-dien-1-ylidene]-ethyl-[3-(furan-2-yl)prop-2-enyl]azanium |
| SMILES | CC[N+](CC=Cc1ccco1)=C1C=CC(c2ccc(N(C)C)cc2)C=C1 |
| InChI | InChI=1S/C23H27N2O/c1-4-25(17-5-7-23-8-6-18-26-23)22-15-11-20(12-16-22)19-9-13-21(14-10-19)24(2)3/h5-16,18,20H,4,17H2,1-3H3/q+1/b7-5?,25-22- |
| InChIKey | MPBLZNWTNQCLHQ-MLDOLBSMSA-N |
| XLogP | 4.74 |
| TPSA | 19.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|