C22H26O2 — CID 91471904
(4aS,5S)-4a-benzyl-3-but-2-enylidene-5-hydroxy-1-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 91471904) has the molecular formula C22H26O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (4aS,5S)-4a-benzyl-3-but-2-enylidene-5-hydroxy-1-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aS,5S)-4a-benzyl-3-but-2-enylidene-5-hydroxy-1-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 91471904 |
| Molecular Formula | C22H26O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (4aS,5S)-4a-benzyl-3-but-2-enylidene-5-hydroxy-1-methyl-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC=CC=C1C[C@@]2(Cc3ccccc3)C(=C(C)C1=O)CCC[C@@H]2O |
| InChI | InChI=1S/C22H26O2/c1-3-4-11-18-15-22(14-17-9-6-5-7-10-17)19(16(2)21(18)24)12-8-13-20(22)23/h3-7,9-11,20,23H,8,12-15H2,1-2H3/t20-,22-/m0/s1 |
| InChIKey | YTHPURXBRIMQLO-UNMCSNQZSA-N |
| XLogP | 4.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|