About 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone
1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone (PubChem CID 91472387) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone |
| PubChem CID | 91472387 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone |
| SMILES | CC(=O)c1cc2sc(C)cc2[nH]1 |
| InChI | InChI=1S/C9H9NOS/c1-5-3-8-9(12-5)4-7(10-8)6(2)11/h3-4,10H,1-2H3 |
| InChIKey | XXGJECJDBAYFIZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone?
The IUPAC name of 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone (CID 91472387) is 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone.
What is the SMILES notation for 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone?
The canonical SMILES for 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone is CC(=O)c1cc2sc(C)cc2[nH]1.
What is the InChIKey of 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone?
The InChIKey is XXGJECJDBAYFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-5-3-8-9(12-5)4-7(10-8)6(2)11/h3-4,10H,1-2H3.
What are the key properties of 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone?
1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone has a molecular weight of 179.24 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-4H-thieno[3,2-b]pyrrol-5-yl)ethanone is sourced from PubChem (CID 91472387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).