C11H15ClF3N — CID 91472447
5-chloro-6-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-quinoline (PubChem CID 91472447) has the molecular formula C11H15ClF3N and a molecular weight of 253.69 g/mol. Its IUPAC name is 5-chloro-6-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-quinoline.
| Compound Name | 5-chloro-6-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-quinoline |
|---|---|
| PubChem CID | 91472447 |
| Molecular Formula | C11H15ClF3N |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 5-chloro-6-methylidene-2-(trifluoromethyl)-2,3,4,4a,5,7,8,8a-octahydro-1H-quinoline |
| SMILES | C=C1CCC2NC(C(F)(F)F)CCC2C1Cl |
| InChI | InChI=1S/C11H15ClF3N/c1-6-2-4-8-7(10(6)12)3-5-9(16-8)11(13,14)15/h7-10,16H,1-5H2 |
| InChIKey | VAJWBRDZGVYYEY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|