C9H11NO — CID 91472754
2-methyl-3,3a,4,7a-tetrahydroindol-5-one (PubChem CID 91472754) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-methyl-3,3a,4,7a-tetrahydroindol-5-one.
| Compound Name | 2-methyl-3,3a,4,7a-tetrahydroindol-5-one |
|---|---|
| PubChem CID | 91472754 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 2-methyl-3,3a,4,7a-tetrahydroindol-5-one |
| SMILES | CC1=NC2C=CC(=O)CC2C1 |
| InChI | InChI=1S/C9H11NO/c1-6-4-7-5-8(11)2-3-9(7)10-6/h2-3,7,9H,4-5H2,1H3 |
| InChIKey | WNNGTOHIULQSGD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |