About 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione
1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione (PubChem CID 91472781) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione.
Molecular Properties
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione |
| PubChem CID | 91472781 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione |
| SMILES | C=C(OC)C(=O)CC(=O)C1=CCCO1 |
| InChI | InChI=1S/C10H12O4/c1-7(13-2)8(11)6-9(12)10-4-3-5-14-10/h4H,1,3,5-6H2,2H3 |
| InChIKey | ISDBHIXOEDRXRR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione?
The IUPAC name of 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione (CID 91472781) is 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione.
What is the SMILES notation for 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione?
The canonical SMILES for 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione is C=C(OC)C(=O)CC(=O)C1=CCCO1.
What is the InChIKey of 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione?
The InChIKey is ISDBHIXOEDRXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-7(13-2)8(11)6-9(12)10-4-3-5-14-10/h4H,1,3,5-6H2,2H3.
What are the key properties of 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione?
1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione has a molecular weight of 196.20 g/mol, XLogP of 0.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydrofuran-5-yl)-4-methoxypent-4-ene-1,3-dione is sourced from PubChem (CID 91472781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).