About 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole
3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole (PubChem CID 91473321) has the molecular formula C13H10BrNOS
and a molecular weight of 308.20 g/mol. Its IUPAC name is 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole |
| PubChem CID | 91473321 |
| Molecular Formula | C13H10BrNOS |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole |
| SMILES | BrC1=CC(c2cc(-c3ccccc3)cs2)ON1 |
| InChI | InChI=1S/C13H10BrNOS/c14-13-7-11(16-15-13)12-6-10(8-17-12)9-4-2-1-3-5-9/h1-8,11,15H |
| InChIKey | RHPQXOXPKKGWID-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole?
The IUPAC name of 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole (CID 91473321) is 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole is BrC1=CC(c2cc(-c3ccccc3)cs2)ON1.
What is the InChIKey of 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole?
The InChIKey is RHPQXOXPKKGWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrNOS/c14-13-7-11(16-15-13)12-6-10(8-17-12)9-4-2-1-3-5-9/h1-8,11,15H.
What are the key properties of 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole?
3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole has a molecular weight of 308.20 g/mol, XLogP of 4.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(4-phenylthiophen-2-yl)-2,5-dihydro-1,2-oxazole is sourced from PubChem (CID 91473321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).