C22H19N5O4 — CID 9147333
2-(3,4-dimethyl-6-oxo-1-phenylpyrazolo[5,4-b]pyridin-7-yl)-N-(3-nitrophenyl)acetamide (PubChem CID 9147333) has the molecular formula C22H19N5O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 2-(3,4-dimethyl-6-oxo-1-phenylpyrazolo[5,4-b]pyridin-7-yl)-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-(3,4-dimethyl-6-oxo-1-phenylpyrazolo[5,4-b]pyridin-7-yl)-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9147333 |
| Molecular Formula | C22H19N5O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(3,4-dimethyl-6-oxo-1-phenylpyrazolo[5,4-b]pyridin-7-yl)-N-(3-nitrophenyl)acetamide |
| SMILES | Cc1cc(=O)n(CC(=O)Nc2cccc([N+](=O)[O-])c2)c2c1c(C)nn2-c1ccccc1 |
| InChI | InChI=1S/C22H19N5O4/c1-14-11-20(29)25(13-19(28)23-16-7-6-10-18(12-16)27(30)31)22-21(14)15(2)24-26(22)17-8-4-3-5-9-17/h3-12H,13H2,1-2H3,(H,23,28) |
| InChIKey | DNVGLCYUUOQMLM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|