C17H18ClF3N4O2S — CID 91473421
1-[(4-chlorophenyl)methoxy]-2-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]guanidine (PubChem CID 91473421) has the molecular formula C17H18ClF3N4O2S and a molecular weight of 434.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methoxy]-2-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]guanidine.
| Compound Name | 1-[(4-chlorophenyl)methoxy]-2-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]guanidine |
|---|---|
| PubChem CID | 91473421 |
| Molecular Formula | C17H18ClF3N4O2S |
| Molecular Weight | 434.87 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methoxy]-2-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]guanidine |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)=S(C)(=O)N=C(N)NOCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClF3N4O2S/c1-11(13-5-8-15(23-9-13)17(19,20)21)28(2,26)25-16(22)24-27-10-12-3-6-14(18)7-4-12/h3-9H,10H2,1-2H3,(H3,22,24,25,26) |
| InChIKey | KTFSYFYHNCSHFL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.87 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|