About 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione
2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione (PubChem CID 91473668) has the molecular formula C19H37N5O3
and a molecular weight of 383.54 g/mol. Its IUPAC name is 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione |
| PubChem CID | 91473668 |
| Molecular Formula | C19H37N5O3 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.29 |
| IUPAC Name | 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione |
| SMILES | CCN(CC)C(=O)CN.CCN1CC(=O)N(CCC2CCNCC2)CC1=O |
| InChI | InChI=1S/C13H23N3O2.C6H14N2O/c1-2-15-9-13(18)16(10-12(15)17)8-5-11-3-6-14-7-4-11;1-3-8(4-2)6(9)5-7/h11,14H,2-10H2,1H3;3-5,7H2,1-2H3 |
| InChIKey | YJQGQQULDZUBIY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione?
The IUPAC name of 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione (CID 91473668) is 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione.
What is the SMILES notation for 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione?
The canonical SMILES for 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione is CCN(CC)C(=O)CN.CCN1CC(=O)N(CCC2CCNCC2)CC1=O.
What is the InChIKey of 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione?
The InChIKey is YJQGQQULDZUBIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2.C6H14N2O/c1-2-15-9-13(18)16(10-12(15)17)8-5-11-3-6-14-7-4-11;1-3-8(4-2)6(9)5-7/h11,14H,2-10H2,1H3;3-5,7H2,1-2H3.
What are the key properties of 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione?
2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione has a molecular weight of 383.54 g/mol, XLogP of -0.12, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,N-diethylacetamide;1-ethyl-4-(2-piperidin-4-ylethyl)piperazine-2,5-dione is sourced from PubChem (CID 91473668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).