C21H26BF2N4+ — CID 91473698
8-ethenyl-7,8-diethyl-11-fluoro-5-(5-fluoro-2-pyridinyl)-7-methyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(9),10,12-triene (PubChem CID 91473698) has the molecular formula C21H26BF2N4+ and a molecular weight of 383.28 g/mol. Its IUPAC name is 8-ethenyl-7,8-diethyl-11-fluoro-5-(5-fluoro-2-pyridinyl)-7-methyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(9),10,12-triene.
| Compound Name | 8-ethenyl-7,8-diethyl-11-fluoro-5-(5-fluoro-2-pyridinyl)-7-methyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(9),10,12-triene |
|---|---|
| PubChem CID | 91473698 |
| Molecular Formula | C21H26BF2N4+ |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 8-ethenyl-7,8-diethyl-11-fluoro-5-(5-fluoro-2-pyridinyl)-7-methyl-2,5-diaza-9-azonia-6-boratricyclo[7.4.0.02,6]trideca-1(9),10,12-triene |
| SMILES | C=CC1(CC)[n+]2cc(F)ccc2N2CCN(c3ccc(F)cn3)B2C1(C)CC |
| InChI | InChI=1S/C21H26BF2N4/c1-5-20(4)21(6-2,7-3)26-15-17(24)9-11-19(26)28-13-12-27(22(20)28)18-10-8-16(23)14-25-18/h6,8-11,14-15H,2,5,7,12-13H2,1,3-4H3/q+1 |
| InChIKey | ZYLRQNUOIZNPRB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 23.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|