About 1,1-dimethylcyclohexane;ethane
1,1-dimethylcyclohexane;ethane (PubChem CID 91473980) has the molecular formula C14H34
and a molecular weight of 202.43 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;ethane.
Molecular Properties
| Compound Name | 1,1-dimethylcyclohexane;ethane |
| PubChem CID | 91473980 |
| Molecular Formula | C14H34 |
| Molecular Weight | 202.43 g/mol |
| Exact Mass | 202.27 |
| IUPAC Name | 1,1-dimethylcyclohexane;ethane |
| SMILES | CC.CC.CC.CC1(C)CCCCC1 |
| InChI | InChI=1S/C8H16.3C2H6/c1-8(2)6-4-3-5-7-8;3*1-2/h3-7H2,1-2H3;3*1-2H3 |
| InChIKey | NOLPLYINGLJMEL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 202.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dimethylcyclohexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylcyclohexane;ethane?
The IUPAC name of 1,1-dimethylcyclohexane;ethane (CID 91473980) is 1,1-dimethylcyclohexane;ethane.
What is the SMILES notation for 1,1-dimethylcyclohexane;ethane?
The canonical SMILES for 1,1-dimethylcyclohexane;ethane is CC.CC.CC.CC1(C)CCCCC1.
What is the InChIKey of 1,1-dimethylcyclohexane;ethane?
The InChIKey is NOLPLYINGLJMEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16.3C2H6/c1-8(2)6-4-3-5-7-8;3*1-2/h3-7H2,1-2H3;3*1-2H3.
What are the key properties of 1,1-dimethylcyclohexane;ethane?
1,1-dimethylcyclohexane;ethane has a molecular weight of 202.43 g/mol, XLogP of 6.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylcyclohexane;ethane is sourced from PubChem (CID 91473980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).