About N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide
N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide (PubChem CID 91474215) has the molecular formula C10H14N2O
and a molecular weight of 178.23 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide |
| PubChem CID | 91474215 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide |
| SMILES | [H]/N=C(\C)CC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C10H14N2O/c1-8(11)7-10(13)12-9-5-3-2-4-6-9/h3,5-6,11H,2,4,7H2,1H3,(H,12,13)/b11-8+ |
| InChIKey | AJYPQKORIPLOED-DHZHZOJOSA-N |
| XLogP | 1.77 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide (CID 91474215) is N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide is [H]/N=C(\C)CC(=O)NC1=CCCC=C1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide?
The InChIKey is AJYPQKORIPLOED-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H14N2O/c1-8(11)7-10(13)12-9-5-3-2-4-6-9/h3,5-6,11H,2,4,7H2,1H3,(H,12,13)/b11-8+.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide?
N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide has a molecular weight of 178.23 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-3-iminobutanamide is sourced from PubChem (CID 91474215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).