About (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate
(1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate (PubChem CID 91474839) has the molecular formula C14H12N4O4
and a molecular weight of 300.27 g/mol. Its IUPAC name is (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate |
| PubChem CID | 91474839 |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate |
| SMILES | NC(=O)C1(OC(=O)c2cc(-c3ccncc3)n[nH]c2=O)CC1 |
| InChI | InChI=1S/C14H12N4O4/c15-13(21)14(3-4-14)22-12(20)9-7-10(17-18-11(9)19)8-1-5-16-6-2-8/h1-2,5-7H,3-4H2,(H2,15,21)(H,18,19) |
| InChIKey | PNPKVEABCBPIIE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate?
The IUPAC name of (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate (CID 91474839) is (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate.
What is the SMILES notation for (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate?
The canonical SMILES for (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate is NC(=O)C1(OC(=O)c2cc(-c3ccncc3)n[nH]c2=O)CC1.
What is the InChIKey of (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate?
The InChIKey is PNPKVEABCBPIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O4/c15-13(21)14(3-4-14)22-12(20)9-7-10(17-18-11(9)19)8-1-5-16-6-2-8/h1-2,5-7H,3-4H2,(H2,15,21)(H,18,19).
What are the key properties of (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate?
(1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate has a molecular weight of 300.27 g/mol, XLogP of 0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclopropyl) 6-oxo-3-pyridin-4-yl-1H-pyridazine-5-carboxylate is sourced from PubChem (CID 91474839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).