About N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine)
N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) (PubChem CID 91475055) has the molecular formula C26H58N6O
and a molecular weight of 470.79 g/mol. Its IUPAC name is N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine).
Molecular Properties
| Compound Name | N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) |
| PubChem CID | 91475055 |
| Molecular Formula | C26H58N6O |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 470.47 |
| IUPAC Name | N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) |
| SMILES | CN(C)CCN1CCCCC1.CN(C)CCN1CCCCC1.CN(C)CCN1CCOCC1 |
| InChI | InChI=1S/2C9H20N2.C8H18N2O/c2*1-10(2)8-9-11-6-4-3-5-7-11;1-9(2)3-4-10-5-7-11-8-6-10/h2*3-9H2,1-2H3;3-8H2,1-2H3 |
| InChIKey | VIXPGYORJCGUBW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 28.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine)?
The IUPAC name of N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) (CID 91475055) is N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine).
What is the SMILES notation for N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine)?
The canonical SMILES for N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) is CN(C)CCN1CCCCC1.CN(C)CCN1CCCCC1.CN(C)CCN1CCOCC1.
What is the InChIKey of N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine)?
The InChIKey is VIXPGYORJCGUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H20N2.C8H18N2O/c2*1-10(2)8-9-11-6-4-3-5-7-11;1-9(2)3-4-10-5-7-11-8-6-10/h2*3-9H2,1-2H3;3-8H2,1-2H3.
What are the key properties of N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine)?
N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) has a molecular weight of 470.79 g/mol, XLogP of 1.95, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-morpholin-4-ylethanamine;bis(N,N-dimethyl-2-piperidin-1-ylethanamine) is sourced from PubChem (CID 91475055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).