C8H11NO — CID 91475611
5-methylidene-4,6,7,7a-tetrahydro-3aH-furo[2,3-b]pyridine (PubChem CID 91475611) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 5-methylidene-4,6,7,7a-tetrahydro-3aH-furo[2,3-b]pyridine.
| Compound Name | 5-methylidene-4,6,7,7a-tetrahydro-3aH-furo[2,3-b]pyridine |
|---|---|
| PubChem CID | 91475611 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 5-methylidene-4,6,7,7a-tetrahydro-3aH-furo[2,3-b]pyridine |
| SMILES | C=C1CNC2OC=CC2C1 |
| InChI | InChI=1S/C8H11NO/c1-6-4-7-2-3-10-8(7)9-5-6/h2-3,7-9H,1,4-5H2 |
| InChIKey | BHHZOHJOUQFAIW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|