C28H35FN4O3S — CID 91475661
(1R,7R,8S)-4-[[(2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol (PubChem CID 91475661) has the molecular formula C28H35FN4O3S and a molecular weight of 526.68 g/mol. Its IUPAC name is (1R,7R,8S)-4-[[(2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol.
| Compound Name | (1R,7R,8S)-4-[[(2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
|---|---|
| PubChem CID | 91475661 |
| Molecular Formula | C28H35FN4O3S |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (1R,7R,8S)-4-[[(2R)-2-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-8-fluoro-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5,8-triol |
| SMILES | Oc1c2c(c(O)n1CC1CCCC[C@H]1CN1CCN(c3nsc4ccccc34)CC1)[C@H]1C[C@@H]2C[C@]1(O)F |
| InChI | InChI=1S/C28H35FN4O3S/c29-28(36)14-19-13-21(28)24-23(19)26(34)33(27(24)35)16-18-6-2-1-5-17(18)15-31-9-11-32(12-10-31)25-20-7-3-4-8-22(20)37-30-25/h3-4,7-8,17-19,21,34-36H,1-2,5-6,9-16H2/t17-,18?,19+,21+,28+/m0/s1 |
| InChIKey | JVYFLUWKJXDOPX-VZPMYUCBSA-N |
| XLogP | 4.77 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |