About 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane
10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane (PubChem CID 91475760) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane.
Molecular Properties
| Compound Name | 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane |
| PubChem CID | 91475760 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane |
| SMILES | CCOC12CC13CC2CC1CCCCC13 |
| InChI | InChI=1S/C14H22O/c1-2-15-14-9-13(14)8-11(14)7-10-5-3-4-6-12(10)13/h10-12H,2-9H2,1H3 |
| InChIKey | NRZTYVAUKHGZOD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane?
The IUPAC name of 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane (CID 91475760) is 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane.
What is the SMILES notation for 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane?
The canonical SMILES for 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane is CCOC12CC13CC2CC1CCCCC13.
What is the InChIKey of 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane?
The InChIKey is NRZTYVAUKHGZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O/c1-2-15-14-9-13(14)8-11(14)7-10-5-3-4-6-12(10)13/h10-12H,2-9H2,1H3.
What are the key properties of 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane?
10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane has a molecular weight of 206.33 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethoxytetracyclo[7.2.1.01,10.02,7]dodecane is sourced from PubChem (CID 91475760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).