About 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol
1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol (PubChem CID 91475778) has the molecular formula C10H19OS+
and a molecular weight of 187.33 g/mol. Its IUPAC name is 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol.
Molecular Properties
| Compound Name | 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol |
| PubChem CID | 91475778 |
| Molecular Formula | C10H19OS+ |
| Molecular Weight | 187.33 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol |
| SMILES | [CH2+]S(C)(C)CC(O)C1C=CCC1 |
| InChI | InChI=1S/C10H19OS/c1-12(2,3)8-10(11)9-6-4-5-7-9/h4,6,9-11H,1,5,7-8H2,2-3H3/q+1 |
| InChIKey | OTXRFKWGTGZFCY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol?
The IUPAC name of 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol (CID 91475778) is 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol.
What is the SMILES notation for 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol?
The canonical SMILES for 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol is [CH2+]S(C)(C)CC(O)C1C=CCC1.
What is the InChIKey of 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol?
The InChIKey is OTXRFKWGTGZFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19OS/c1-12(2,3)8-10(11)9-6-4-5-7-9/h4,6,9-11H,1,5,7-8H2,2-3H3/q+1.
What are the key properties of 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol?
1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol has a molecular weight of 187.33 g/mol, XLogP of 2.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopent-2-en-1-yl-2-[dimethyl(methyl)-λ4-sulfanyl]ethanol is sourced from PubChem (CID 91475778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).