C11H14N2O2 — CID 91475814
2-nitroso-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 91475814) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-nitroso-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-nitroso-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 91475814 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-nitroso-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1NC(=O)CN=O |
| InChI | InChI=1S/C11H14N2O2/c1-8(2)9-5-3-4-6-10(9)13-11(14)7-12-15/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | GEZYXMZRTJISPX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |