About spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine
spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine (PubChem CID 91475890) has the molecular formula C15H12N2OS
and a molecular weight of 268.34 g/mol. Its IUPAC name is spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine.
Molecular Properties
| Compound Name | spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine |
| PubChem CID | 91475890 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine |
| SMILES | NC1=NC2(CS1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C15H12N2OS/c16-14-17-15(9-19-14)10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)15/h1-8H,9H2,(H2,16,17) |
| InChIKey | HGXZZPXUFOPAJF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
The IUPAC name of spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine (CID 91475890) is spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine.
What is the SMILES notation for spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
The canonical SMILES for spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine is NC1=NC2(CS1)c1ccccc1Oc1ccccc12.
What is the InChIKey of spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
The InChIKey is HGXZZPXUFOPAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2OS/c16-14-17-15(9-19-14)10-5-1-3-7-12(10)18-13-8-4-2-6-11(13)15/h1-8H,9H2,(H2,16,17).
What are the key properties of spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine?
spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine has a molecular weight of 268.34 g/mol, XLogP of 3.10, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[5H-1,3-thiazole-4,9'-xanthene]-2-amine is sourced from PubChem (CID 91475890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).